C19H14N2O4 — CID 67028477
2-[(5-methoxy-1H-indol-3-yl)methylidene]-3-oxo-1-benzofuran-6-carboxamide (PubChem CID 67028477) has the molecular formula C19H14N2O4 and a molecular weight of 334.33 g/mol. Its IUPAC name is 2-[(5-methoxy-1H-indol-3-yl)methylidene]-3-oxo-1-benzofuran-6-carboxamide.
| Compound Name | 2-[(5-methoxy-1H-indol-3-yl)methylidene]-3-oxo-1-benzofuran-6-carboxamide |
|---|---|
| PubChem CID | 67028477 |
| Molecular Formula | C19H14N2O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-[(5-methoxy-1H-indol-3-yl)methylidene]-3-oxo-1-benzofuran-6-carboxamide |
| SMILES | COc1ccc2[nH]cc(C=C3Oc4cc(C(N)=O)ccc4C3=O)c2c1 |
| InChI | InChI=1S/C19H14N2O4/c1-24-12-3-5-15-14(8-12)11(9-21-15)7-17-18(22)13-4-2-10(19(20)23)6-16(13)25-17/h2-9,21H,1H3,(H2,20,23) |
| InChIKey | LKQNCMASUYHRBA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 94.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|