C27H28N4O5 — CID 67027971
1-[2-[[5-methoxy-7-(3-morpholin-4-ylprop-1-enyl)-1H-indol-3-yl]methylidene]-3-oxo-1-benzofuran-5-yl]-3-methylurea (PubChem CID 67027971) has the molecular formula C27H28N4O5 and a molecular weight of 488.54 g/mol. Its IUPAC name is 1-[2-[[5-methoxy-7-(3-morpholin-4-ylprop-1-enyl)-1H-indol-3-yl]methylidene]-3-oxo-1-benzofuran-5-yl]-3-methylurea.
| Compound Name | 1-[2-[[5-methoxy-7-(3-morpholin-4-ylprop-1-enyl)-1H-indol-3-yl]methylidene]-3-oxo-1-benzofuran-5-yl]-3-methylurea |
|---|---|
| PubChem CID | 67027971 |
| Molecular Formula | C27H28N4O5 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 1-[2-[[5-methoxy-7-(3-morpholin-4-ylprop-1-enyl)-1H-indol-3-yl]methylidene]-3-oxo-1-benzofuran-5-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc2c(c1)C(=O)C(=Cc1c[nH]c3c(C=CCN4CCOCC4)cc(OC)cc13)O2 |
| InChI | InChI=1S/C27H28N4O5/c1-28-27(33)30-19-5-6-23-22(14-19)26(32)24(36-23)13-18-16-29-25-17(12-20(34-2)15-21(18)25)4-3-7-31-8-10-35-11-9-31/h3-6,12-16,29H,7-11H2,1-2H3,(H2,28,30,33) |
| InChIKey | RWKONPIRZLNGQK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|