C22H19FN4OS — CID 143915420
5-[4-(dimethylamino)quinolin-6-yl]-3-[(4-fluorophenyl)sulfanylamino]-1H-pyridin-2-one (PubChem CID 143915420) has the molecular formula C22H19FN4OS and a molecular weight of 406.49 g/mol. Its IUPAC name is 5-[4-(dimethylamino)quinolin-6-yl]-3-[(4-fluorophenyl)sulfanylamino]-1H-pyridin-2-one.
| Compound Name | 5-[4-(dimethylamino)quinolin-6-yl]-3-[(4-fluorophenyl)sulfanylamino]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 143915420 |
| Molecular Formula | C22H19FN4OS |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 5-[4-(dimethylamino)quinolin-6-yl]-3-[(4-fluorophenyl)sulfanylamino]-1H-pyridin-2-one |
| SMILES | CN(C)c1ccnc2ccc(-c3c[nH]c(=O)c(NSc4ccc(F)cc4)c3)cc12 |
| InChI | InChI=1S/C22H19FN4OS/c1-27(2)21-9-10-24-19-8-3-14(11-18(19)21)15-12-20(22(28)25-13-15)26-29-17-6-4-16(23)5-7-17/h3-13,26H,1-2H3,(H,25,28) |
| InChIKey | SUJBYTFPLSVQGU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|