C21H15F2N3S2 — CID 139570965
1-N,4-N-bis[(4-fluorophenyl)sulfanyl]isoquinoline-1,4-diamine (PubChem CID 139570965) has the molecular formula C21H15F2N3S2 and a molecular weight of 411.50 g/mol. Its IUPAC name is 1-N,4-N-bis[(4-fluorophenyl)sulfanyl]isoquinoline-1,4-diamine.
| Compound Name | 1-N,4-N-bis[(4-fluorophenyl)sulfanyl]isoquinoline-1,4-diamine |
|---|---|
| PubChem CID | 139570965 |
| Molecular Formula | C21H15F2N3S2 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 1-N,4-N-bis[(4-fluorophenyl)sulfanyl]isoquinoline-1,4-diamine |
| SMILES | Fc1ccc(SNc2cnc(NSc3ccc(F)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C21H15F2N3S2/c22-14-5-9-16(10-6-14)27-25-20-13-24-21(19-4-2-1-3-18(19)20)26-28-17-11-7-15(23)8-12-17/h1-13,25H,(H,24,26) |
| InChIKey | CXVAQZKAJDLEGF-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|