C20H16ClFN4S — CID 130329601
5-[2-(4-chloro-6-ethylpyrimidin-5-yl)ethynyl]-N-(4-fluorophenyl)sulfanyl-2-methylpyridin-3-amine (PubChem CID 130329601) has the molecular formula C20H16ClFN4S and a molecular weight of 398.89 g/mol. Its IUPAC name is 5-[2-(4-chloro-6-ethylpyrimidin-5-yl)ethynyl]-N-(4-fluorophenyl)sulfanyl-2-methylpyridin-3-amine.
| Compound Name | 5-[2-(4-chloro-6-ethylpyrimidin-5-yl)ethynyl]-N-(4-fluorophenyl)sulfanyl-2-methylpyridin-3-amine |
|---|---|
| PubChem CID | 130329601 |
| Molecular Formula | C20H16ClFN4S |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 5-[2-(4-chloro-6-ethylpyrimidin-5-yl)ethynyl]-N-(4-fluorophenyl)sulfanyl-2-methylpyridin-3-amine |
| SMILES | CCc1ncnc(Cl)c1C#Cc1cnc(C)c(NSc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H16ClFN4S/c1-3-18-17(20(21)25-12-24-18)9-4-14-10-19(13(2)23-11-14)26-27-16-7-5-15(22)6-8-16/h5-8,10-12,26H,3H2,1-2H3 |
| InChIKey | RLHAXSIPOZAEFB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|