C7H15N3O2 — CID 143915729
(Z)-3-amino-N-(3-hydroxypropyl)-2-(methylamino)prop-2-enamide (PubChem CID 143915729) has the molecular formula C7H15N3O2 and a molecular weight of 173.22 g/mol. Its IUPAC name is (Z)-3-amino-N-(3-hydroxypropyl)-2-(methylamino)prop-2-enamide.
| Compound Name | (Z)-3-amino-N-(3-hydroxypropyl)-2-(methylamino)prop-2-enamide |
|---|---|
| PubChem CID | 143915729 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (Z)-3-amino-N-(3-hydroxypropyl)-2-(methylamino)prop-2-enamide |
| SMILES | CN/C(=C\N)C(=O)NCCCO |
| InChI | InChI=1S/C7H15N3O2/c1-9-6(5-8)7(12)10-3-2-4-11/h5,9,11H,2-4,8H2,1H3,(H,10,12)/b6-5- |
| InChIKey | LWQAMTJTTYZOAP-WAYWQWQTSA-N |
| XLogP | -1.50 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|