C7H11N3O3 — CID 43500338
N-(3-hydroxypropyl)-2-oxo-1,3-dihydroimidazole-4-carboxamide (PubChem CID 43500338) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-2-oxo-1,3-dihydroimidazole-4-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-2-oxo-1,3-dihydroimidazole-4-carboxamide |
|---|---|
| PubChem CID | 43500338 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | N-(3-hydroxypropyl)-2-oxo-1,3-dihydroimidazole-4-carboxamide |
| SMILES | O=C(NCCCO)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C7H11N3O3/c11-3-1-2-8-6(12)5-4-9-7(13)10-5/h4,11H,1-3H2,(H,8,12)(H2,9,10,13) |
| InChIKey | KDRZYCOVAOTUOL-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|