C31H32N4O2S — CID 143915840
N-[2-[2-(ethoxymethyl)-4-[[(2-methylquinolin-4-yl)amino]methyl]phenyl]phenyl]sulfanyl-4,5-dimethyl-1,2-oxazol-3-amine (PubChem CID 143915840) has the molecular formula C31H32N4O2S and a molecular weight of 524.69 g/mol. Its IUPAC name is N-[2-[2-(ethoxymethyl)-4-[[(2-methylquinolin-4-yl)amino]methyl]phenyl]phenyl]sulfanyl-4,5-dimethyl-1,2-oxazol-3-amine.
| Compound Name | N-[2-[2-(ethoxymethyl)-4-[[(2-methylquinolin-4-yl)amino]methyl]phenyl]phenyl]sulfanyl-4,5-dimethyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 143915840 |
| Molecular Formula | C31H32N4O2S |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | N-[2-[2-(ethoxymethyl)-4-[[(2-methylquinolin-4-yl)amino]methyl]phenyl]phenyl]sulfanyl-4,5-dimethyl-1,2-oxazol-3-amine |
| SMILES | CCOCc1cc(CNc2cc(C)nc3ccccc23)ccc1-c1ccccc1SNc1noc(C)c1C |
| InChI | InChI=1S/C31H32N4O2S/c1-5-36-19-24-17-23(18-32-29-16-20(2)33-28-12-8-6-11-27(28)29)14-15-25(24)26-10-7-9-13-30(26)38-35-31-21(3)22(4)37-34-31/h6-17H,5,18-19H2,1-4H3,(H,32,33)(H,34,35) |
| InChIKey | LDPNCHBOGBJOKC-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 72.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|