C20H20N8O — CID 143916106
N,N'-diamino-4-[[8-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzenecarboximidamide (PubChem CID 143916106) has the molecular formula C20H20N8O and a molecular weight of 388.44 g/mol. Its IUPAC name is N,N'-diamino-4-[[8-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzenecarboximidamide.
| Compound Name | N,N'-diamino-4-[[8-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 143916106 |
| Molecular Formula | C20H20N8O |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N,N'-diamino-4-[[8-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzenecarboximidamide |
| SMILES | COc1ccc(-c2cccn3nc(Nc4ccc(/C(=N/N)NN)cc4)nc23)cc1 |
| InChI | InChI=1S/C20H20N8O/c1-29-16-10-6-13(7-11-16)17-3-2-12-28-19(17)24-20(27-28)23-15-8-4-14(5-9-15)18(25-21)26-22/h2-12H,21-22H2,1H3,(H,23,27)(H,25,26) |
| InChIKey | AZVURSYZJPPPKJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|