C26H30N6O — CID 70929679
8-(4-methoxyphenyl)-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 70929679) has the molecular formula C26H30N6O and a molecular weight of 442.57 g/mol. Its IUPAC name is 8-(4-methoxyphenyl)-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-(4-methoxyphenyl)-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 70929679 |
| Molecular Formula | C26H30N6O |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 8-(4-methoxyphenyl)-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | COc1ccc(-c2cccn3nc(Nc4ccc(N5CCN(C(C)C)CC5)cc4)nc23)cc1 |
| InChI | InChI=1S/C26H30N6O/c1-19(2)30-15-17-31(18-16-30)22-10-8-21(9-11-22)27-26-28-25-24(5-4-14-32(25)29-26)20-6-12-23(33-3)13-7-20/h4-14,19H,15-18H2,1-3H3,(H,27,29) |
| InChIKey | IHSLQKZEQRHZHQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 57.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|