C13H10IN3O — CID 59199096
2-iodo-8-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 59199096) has the molecular formula C13H10IN3O and a molecular weight of 351.15 g/mol. Its IUPAC name is 2-iodo-8-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-iodo-8-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 59199096 |
| Molecular Formula | C13H10IN3O |
| Molecular Weight | 351.15 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 2-iodo-8-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1ccc(-c2cccn3nc(I)nc23)cc1 |
| InChI | InChI=1S/C13H10IN3O/c1-18-10-6-4-9(5-7-10)11-3-2-8-17-12(11)15-13(14)16-17/h2-8H,1H3 |
| InChIKey | ZPXOTNJFDVKGFS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.15 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|