C40H34N8O6S2 — CID 68796293
1,2-bis(3-methoxyphenyl)-1,2-bis[8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]hydrazine (PubChem CID 68796293) has the molecular formula C40H34N8O6S2 and a molecular weight of 786.90 g/mol. Its IUPAC name is 1,2-bis(3-methoxyphenyl)-1,2-bis[8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]hydrazine.
| Compound Name | 1,2-bis(3-methoxyphenyl)-1,2-bis[8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]hydrazine |
|---|---|
| PubChem CID | 68796293 |
| Molecular Formula | C40H34N8O6S2 |
| Molecular Weight | 786.90 g/mol |
| Exact Mass | 786.20 |
| IUPAC Name | 1,2-bis(3-methoxyphenyl)-1,2-bis[8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]hydrazine |
| SMILES | COc1cccc(N(c2nc3c(-c4ccc(S(C)(=O)=O)cc4)cccn3n2)N(c2cccc(OC)c2)c2nc3c(-c4ccc(S(C)(=O)=O)cc4)cccn3n2)c1 |
| InChI | InChI=1S/C40H34N8O6S2/c1-53-31-11-5-9-29(25-31)47(39-41-37-35(13-7-23-45(37)43-39)27-15-19-33(20-16-27)55(3,49)50)48(30-10-6-12-32(26-30)54-2)40-42-38-36(14-8-24-46(38)44-40)28-17-21-34(22-18-28)56(4,51)52/h5-26H,1-4H3 |
| InChIKey | KGFZJGPUTJDPQE-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 153.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.90 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|