C25H26N4O2S — CID 59612354
8-(4-methylsulfonylphenyl)-2-[(4-piperidin-1-ylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 59612354) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is 8-(4-methylsulfonylphenyl)-2-[(4-piperidin-1-ylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-(4-methylsulfonylphenyl)-2-[(4-piperidin-1-ylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 59612354 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 8-(4-methylsulfonylphenyl)-2-[(4-piperidin-1-ylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CS(=O)(=O)c1ccc(-c2cccn3nc(Cc4ccc(N5CCCCC5)cc4)nc23)cc1 |
| InChI | InChI=1S/C25H26N4O2S/c1-32(30,31)22-13-9-20(10-14-22)23-6-5-17-29-25(23)26-24(27-29)18-19-7-11-21(12-8-19)28-15-3-2-4-16-28/h5-14,17H,2-4,15-16,18H2,1H3 |
| InChIKey | UCGNYEWYMMNUGM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|