C13H9N3O2S — CID 67481414
5-(4-methylsulfonylphenyl)-1,7,9-triazatricyclo[4.3.0.02,8]nona-2,4,6,8-tetraene (PubChem CID 67481414) has the molecular formula C13H9N3O2S and a molecular weight of 271.30 g/mol. Its IUPAC name is 5-(4-methylsulfonylphenyl)-1,7,9-triazatricyclo[4.3.0.02,8]nona-2,4,6,8-tetraene.
| Compound Name | 5-(4-methylsulfonylphenyl)-1,7,9-triazatricyclo[4.3.0.02,8]nona-2,4,6,8-tetraene |
|---|---|
| PubChem CID | 67481414 |
| Molecular Formula | C13H9N3O2S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 5-(4-methylsulfonylphenyl)-1,7,9-triazatricyclo[4.3.0.02,8]nona-2,4,6,8-tetraene |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc3c4nc2n3n4)cc1 |
| InChI | InChI=1S/C13H9N3O2S/c1-19(17,18)9-4-2-8(3-5-9)10-6-7-11-12-14-13(10)16(11)15-12/h2-7H,1H3 |
| InChIKey | MQCFPDXVBZMRRL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 64.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |