About 2-methoxy-8-methyl-[1,2,4]triazolo[1,5-a]pyridine
2-methoxy-8-methyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 116989886) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-methoxy-8-methyl-[1,2,4]triazolo[1,5-a]pyridine.
Analyze 2-methoxy-8-methyl-[1,2,4]triazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-8-methyl-[1,2,4]triazolo[1,5-a]pyridine?
The IUPAC name of 2-methoxy-8-methyl-[1,2,4]triazolo[1,5-a]pyridine (CID 116989886) is 2-methoxy-8-methyl-[1,2,4]triazolo[1,5-a]pyridine.
What is the SMILES notation for 2-methoxy-8-methyl-[1,2,4]triazolo[1,5-a]pyridine?
The canonical SMILES for 2-methoxy-8-methyl-[1,2,4]triazolo[1,5-a]pyridine is COc1nc2c(C)cccn2n1.
What is the InChIKey of 2-methoxy-8-methyl-[1,2,4]triazolo[1,5-a]pyridine?
The InChIKey is LIOFUXFBQOKSKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-6-4-3-5-11-7(6)9-8(10-11)12-2/h3-5H,1-2H3.
What are the key properties of 2-methoxy-8-methyl-[1,2,4]triazolo[1,5-a]pyridine?
2-methoxy-8-methyl-[1,2,4]triazolo[1,5-a]pyridine has a molecular weight of 163.18 g/mol, XLogP of 1.05, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-8-methyl-[1,2,4]triazolo[1,5-a]pyridine is sourced from PubChem (CID 116989886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).