methyl 3-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoate

C11H13N3O2 — CID 116989828

IUPACmethyl 3-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoate
SMILESCOC(=O)CCc1nc2c(C)cccn2n1
InChIInChI=1S/C11H13N3O2/c1-8-4-3-7-14-11(8)12-9(13-14)5-6-10(15)16-2/h3-4,7H,5-6H2,1-2H3
InChIKeyDXRIOVOXAJFDRO-UHFFFAOYSA-N
MW219.24 g/mol
LogP1.14
Rot. Bonds3

About methyl 3-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoate

methyl 3-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoate (PubChem CID 116989828) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is methyl 3-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoate
PubChem CID116989828
Molecular FormulaC11H13N3O2
Molecular Weight219.24 g/mol
Exact Mass219.10
IUPAC Namemethyl 3-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoate
SMILESCOC(=O)CCc1nc2c(C)cccn2n1
InChIInChI=1S/C11H13N3O2/c1-8-4-3-7-14-11(8)12-9(13-14)5-6-10(15)16-2/h3-4,7H,5-6H2,1-2H3
InChIKeyDXRIOVOXAJFDRO-UHFFFAOYSA-N
XLogP1.14
TPSA56.49 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.24
LogP ≤ 51.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 3-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoate?
The IUPAC name of methyl 3-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoate (CID 116989828) is methyl 3-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoate.
What is the SMILES notation for methyl 3-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoate?
The canonical SMILES for methyl 3-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoate is COC(=O)CCc1nc2c(C)cccn2n1.
What is the InChIKey of methyl 3-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoate?
The InChIKey is DXRIOVOXAJFDRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2/c1-8-4-3-7-14-11(8)12-9(13-14)5-6-10(15)16-2/h3-4,7H,5-6H2,1-2H3.
What are the key properties of methyl 3-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoate?
methyl 3-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoate has a molecular weight of 219.24 g/mol, XLogP of 1.14, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoate is sourced from PubChem (CID 116989828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).