C14H14N4O — CID 114332643
2-[[(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]methyl]phenol (PubChem CID 114332643) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-[[(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]methyl]phenol.
| Compound Name | 2-[[(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 114332643 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-[[(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]methyl]phenol |
| SMILES | Cc1cccn2nc(NCc3ccccc3O)nc12 |
| InChI | InChI=1S/C14H14N4O/c1-10-5-4-8-18-13(10)16-14(17-18)15-9-11-6-2-3-7-12(11)19/h2-8,19H,9H2,1H3,(H,15,17) |
| InChIKey | IOTULVFWTUEZFZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|