C13H16N4 — CID 106214508
N-hex-5-ynyl-8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 106214508) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is N-hex-5-ynyl-8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-hex-5-ynyl-8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 106214508 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | N-hex-5-ynyl-8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | C#CCCCCNc1nc2c(C)cccn2n1 |
| InChI | InChI=1S/C13H16N4/c1-3-4-5-6-9-14-13-15-12-11(2)8-7-10-17(12)16-13/h1,7-8,10H,4-6,9H2,2H3,(H,14,16) |
| InChIKey | HZLQXLYRWULZDK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|