C23H34O8 — CID 143916971
[4-[6-(2-methylprop-2-enoyloxy)-2-oxo-4a,5,6,7,8,8a-hexahydrochromen-3-yl]cyclohexyl] 2-methylprop-2-enoate;dihydrate (PubChem CID 143916971) has the molecular formula C23H34O8 and a molecular weight of 438.52 g/mol. Its IUPAC name is [4-[6-(2-methylprop-2-enoyloxy)-2-oxo-4a,5,6,7,8,8a-hexahydrochromen-3-yl]cyclohexyl] 2-methylprop-2-enoate;dihydrate.
| Compound Name | [4-[6-(2-methylprop-2-enoyloxy)-2-oxo-4a,5,6,7,8,8a-hexahydrochromen-3-yl]cyclohexyl] 2-methylprop-2-enoate;dihydrate |
|---|---|
| PubChem CID | 143916971 |
| Molecular Formula | C23H34O8 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | [4-[6-(2-methylprop-2-enoyloxy)-2-oxo-4a,5,6,7,8,8a-hexahydrochromen-3-yl]cyclohexyl] 2-methylprop-2-enoate;dihydrate |
| SMILES | C=C(C)C(=O)OC1CCC(C2=CC3CC(OC(=O)C(=C)C)CCC3OC2=O)CC1.O.O |
| InChI | InChI=1S/C23H30O6.2H2O/c1-13(2)21(24)27-17-7-5-15(6-8-17)19-12-16-11-18(28-22(25)14(3)4)9-10-20(16)29-23(19)26;;/h12,15-18,20H,1,3,5-11H2,2,4H3;2*1H2 |
| InChIKey | PRRHZRIDPSPGNK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 141.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|