C26H27FN2O3S — CID 143917684
methyl 4-[[6-[2-fluoropropyl(pyridin-2-ylsulfanyl)amino]-2,3-dihydro-1H-inden-5-yl]oxymethyl]benzoate (PubChem CID 143917684) has the molecular formula C26H27FN2O3S and a molecular weight of 466.58 g/mol. Its IUPAC name is methyl 4-[[6-[2-fluoropropyl(pyridin-2-ylsulfanyl)amino]-2,3-dihydro-1H-inden-5-yl]oxymethyl]benzoate.
| Compound Name | methyl 4-[[6-[2-fluoropropyl(pyridin-2-ylsulfanyl)amino]-2,3-dihydro-1H-inden-5-yl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 143917684 |
| Molecular Formula | C26H27FN2O3S |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | methyl 4-[[6-[2-fluoropropyl(pyridin-2-ylsulfanyl)amino]-2,3-dihydro-1H-inden-5-yl]oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2cc3c(cc2N(CC(C)F)Sc2ccccn2)CCC3)cc1 |
| InChI | InChI=1S/C26H27FN2O3S/c1-18(27)16-29(33-25-8-3-4-13-28-25)23-14-21-6-5-7-22(21)15-24(23)32-17-19-9-11-20(12-10-19)26(30)31-2/h3-4,8-15,18H,5-7,16-17H2,1-2H3 |
| InChIKey | ZCUZONPWNIYSFO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|