C25H24F2N2O3S — CID 143917730
methyl 4-[[6-[2,2-difluoroethyl(pyridin-2-ylsulfanyl)amino]-2,3-dihydro-1H-inden-5-yl]oxymethyl]benzoate (PubChem CID 143917730) has the molecular formula C25H24F2N2O3S and a molecular weight of 470.54 g/mol. Its IUPAC name is methyl 4-[[6-[2,2-difluoroethyl(pyridin-2-ylsulfanyl)amino]-2,3-dihydro-1H-inden-5-yl]oxymethyl]benzoate.
| Compound Name | methyl 4-[[6-[2,2-difluoroethyl(pyridin-2-ylsulfanyl)amino]-2,3-dihydro-1H-inden-5-yl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 143917730 |
| Molecular Formula | C25H24F2N2O3S |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | methyl 4-[[6-[2,2-difluoroethyl(pyridin-2-ylsulfanyl)amino]-2,3-dihydro-1H-inden-5-yl]oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2cc3c(cc2N(CC(F)F)Sc2ccccn2)CCC3)cc1 |
| InChI | InChI=1S/C25H24F2N2O3S/c1-31-25(30)18-10-8-17(9-11-18)16-32-22-14-20-6-4-5-19(20)13-21(22)29(15-23(26)27)33-24-7-2-3-12-28-24/h2-3,7-14,23H,4-6,15-16H2,1H3 |
| InChIKey | QVUHBRJSIHAHQX-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|