C25H45F2NO7 — CID 143918678
3-[(4,4-difluoro-6-hydroxy-1,8,9-trimethoxy-5,5-dimethylnonyl)amino]-1-(5,6-dimethyl-4-methylideneoxan-2-yl)-1-hydroxypropan-2-one (PubChem CID 143918678) has the molecular formula C25H45F2NO7 and a molecular weight of 509.63 g/mol. Its IUPAC name is 3-[(4,4-difluoro-6-hydroxy-1,8,9-trimethoxy-5,5-dimethylnonyl)amino]-1-(5,6-dimethyl-4-methylideneoxan-2-yl)-1-hydroxypropan-2-one.
| Compound Name | 3-[(4,4-difluoro-6-hydroxy-1,8,9-trimethoxy-5,5-dimethylnonyl)amino]-1-(5,6-dimethyl-4-methylideneoxan-2-yl)-1-hydroxypropan-2-one |
|---|---|
| PubChem CID | 143918678 |
| Molecular Formula | C25H45F2NO7 |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.32 |
| IUPAC Name | 3-[(4,4-difluoro-6-hydroxy-1,8,9-trimethoxy-5,5-dimethylnonyl)amino]-1-(5,6-dimethyl-4-methylideneoxan-2-yl)-1-hydroxypropan-2-one |
| SMILES | C=C1CC(C(O)C(=O)CNC(CCC(F)(F)C(C)(C)C(O)CC(COC)OC)OC)OC(C)C1C |
| InChI | InChI=1S/C25H45F2NO7/c1-15-11-20(35-17(3)16(15)2)23(31)19(29)13-28-22(34-8)9-10-25(26,27)24(4,5)21(30)12-18(33-7)14-32-6/h16-18,20-23,28,30-31H,1,9-14H2,2-8H3 |
| InChIKey | LQRBUSDGIBONAC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|