C18H28N2O — CID 143919440
4-amino-N-(3-methylphenyl)bicyclo[2.2.2]octane-1-carboxamide;ethane (PubChem CID 143919440) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is 4-amino-N-(3-methylphenyl)bicyclo[2.2.2]octane-1-carboxamide;ethane.
| Compound Name | 4-amino-N-(3-methylphenyl)bicyclo[2.2.2]octane-1-carboxamide;ethane |
|---|---|
| PubChem CID | 143919440 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 4-amino-N-(3-methylphenyl)bicyclo[2.2.2]octane-1-carboxamide;ethane |
| SMILES | CC.Cc1cccc(NC(=O)C23CCC(N)(CC2)CC3)c1 |
| InChI | InChI=1S/C16H22N2O.C2H6/c1-12-3-2-4-13(11-12)18-14(19)15-5-8-16(17,9-6-15)10-7-15;1-2/h2-4,11H,5-10,17H2,1H3,(H,18,19);1-2H3 |
| InChIKey | BUIBYEJXWNGLBM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |