About 3-[2-(difluoromethyl)-4-methylphenoxy]propane-1,2-diol;ethane
3-[2-(difluoromethyl)-4-methylphenoxy]propane-1,2-diol;ethane (PubChem CID 143922377) has the molecular formula C13H20F2O3
and a molecular weight of 262.30 g/mol. Its IUPAC name is 3-[2-(difluoromethyl)-4-methylphenoxy]propane-1,2-diol;ethane.
Molecular Properties
| Compound Name | 3-[2-(difluoromethyl)-4-methylphenoxy]propane-1,2-diol;ethane |
| PubChem CID | 143922377 |
| Molecular Formula | C13H20F2O3 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3-[2-(difluoromethyl)-4-methylphenoxy]propane-1,2-diol;ethane |
| SMILES | CC.Cc1ccc(OCC(O)CO)c(C(F)F)c1 |
| InChI | InChI=1S/C11H14F2O3.C2H6/c1-7-2-3-10(9(4-7)11(12)13)16-6-8(15)5-14;1-2/h2-4,8,11,14-15H,5-6H2,1H3;1-2H3 |
| InChIKey | WIEZZAWDFKPBRE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(difluoromethyl)-4-methylphenoxy]propane-1,2-diol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(difluoromethyl)-4-methylphenoxy]propane-1,2-diol;ethane?
The IUPAC name of 3-[2-(difluoromethyl)-4-methylphenoxy]propane-1,2-diol;ethane (CID 143922377) is 3-[2-(difluoromethyl)-4-methylphenoxy]propane-1,2-diol;ethane.
What is the SMILES notation for 3-[2-(difluoromethyl)-4-methylphenoxy]propane-1,2-diol;ethane?
The canonical SMILES for 3-[2-(difluoromethyl)-4-methylphenoxy]propane-1,2-diol;ethane is CC.Cc1ccc(OCC(O)CO)c(C(F)F)c1.
What is the InChIKey of 3-[2-(difluoromethyl)-4-methylphenoxy]propane-1,2-diol;ethane?
The InChIKey is WIEZZAWDFKPBRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2O3.C2H6/c1-7-2-3-10(9(4-7)11(12)13)16-6-8(15)5-14;1-2/h2-4,8,11,14-15H,5-6H2,1H3;1-2H3.
What are the key properties of 3-[2-(difluoromethyl)-4-methylphenoxy]propane-1,2-diol;ethane?
3-[2-(difluoromethyl)-4-methylphenoxy]propane-1,2-diol;ethane has a molecular weight of 262.30 g/mol, XLogP of 2.69, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(difluoromethyl)-4-methylphenoxy]propane-1,2-diol;ethane is sourced from PubChem (CID 143922377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).