C13H20F2O3 — CID 143922377
3-[2-(difluoromethyl)-4-methylphenoxy]propane-1,2-diol;ethane (PubChem CID 143922377) has the molecular formula C13H20F2O3 and a molecular weight of 262.30 g/mol. Its IUPAC name is 3-[2-(difluoromethyl)-4-methylphenoxy]propane-1,2-diol;ethane.
| Compound Name | 3-[2-(difluoromethyl)-4-methylphenoxy]propane-1,2-diol;ethane |
|---|---|
| PubChem CID | 143922377 |
| Molecular Formula | C13H20F2O3 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3-[2-(difluoromethyl)-4-methylphenoxy]propane-1,2-diol;ethane |
| SMILES | CC.Cc1ccc(OCC(O)CO)c(C(F)F)c1 |
| InChI | InChI=1S/C11H14F2O3.C2H6/c1-7-2-3-10(9(4-7)11(12)13)16-6-8(15)5-14;1-2/h2-4,8,11,14-15H,5-6H2,1H3;1-2H3 |
| InChIKey | WIEZZAWDFKPBRE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |