C12H18O4 — CID 82849372
3-[2-[(1R)-1-hydroxyethyl]-4-methylphenoxy]propane-1,2-diol (PubChem CID 82849372) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 3-[2-[(1R)-1-hydroxyethyl]-4-methylphenoxy]propane-1,2-diol.
| Compound Name | 3-[2-[(1R)-1-hydroxyethyl]-4-methylphenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 82849372 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3-[2-[(1R)-1-hydroxyethyl]-4-methylphenoxy]propane-1,2-diol |
| SMILES | Cc1ccc(OCC(O)CO)c([C@@H](C)O)c1 |
| InChI | InChI=1S/C12H18O4/c1-8-3-4-12(11(5-8)9(2)14)16-7-10(15)6-13/h3-5,9-10,13-15H,6-7H2,1-2H3/t9-,10?/m1/s1 |
| InChIKey | VBLFHUNLATVLHC-YHMJZVADSA-N |
| XLogP | 0.78 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |