C17H16ClN3O3 — CID 143923014
2-(3-chloro-4-hydroxyanilino)-3-ethyl-9-methoxypyrido[1,2-a]pyrimidin-4-one (PubChem CID 143923014) has the molecular formula C17H16ClN3O3 and a molecular weight of 345.79 g/mol. Its IUPAC name is 2-(3-chloro-4-hydroxyanilino)-3-ethyl-9-methoxypyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(3-chloro-4-hydroxyanilino)-3-ethyl-9-methoxypyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 143923014 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-(3-chloro-4-hydroxyanilino)-3-ethyl-9-methoxypyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCc1c(Nc2ccc(O)c(Cl)c2)nc2c(OC)cccn2c1=O |
| InChI | InChI=1S/C17H16ClN3O3/c1-3-11-15(19-10-6-7-13(22)12(18)9-10)20-16-14(24-2)5-4-8-21(16)17(11)23/h4-9,19,22H,3H2,1-2H3 |
| InChIKey | PDINMAANSRUKQD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|