C17H18N3O6P — CID 123555660
[4-[[3-(hydroxymethyl)-9-methoxy-4-oxopyrido[1,2-a]pyrimidin-2-yl]amino]phenyl]methylphosphonic acid (PubChem CID 123555660) has the molecular formula C17H18N3O6P and a molecular weight of 391.32 g/mol. Its IUPAC name is [4-[[3-(hydroxymethyl)-9-methoxy-4-oxopyrido[1,2-a]pyrimidin-2-yl]amino]phenyl]methylphosphonic acid.
| Compound Name | [4-[[3-(hydroxymethyl)-9-methoxy-4-oxopyrido[1,2-a]pyrimidin-2-yl]amino]phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 123555660 |
| Molecular Formula | C17H18N3O6P |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | [4-[[3-(hydroxymethyl)-9-methoxy-4-oxopyrido[1,2-a]pyrimidin-2-yl]amino]phenyl]methylphosphonic acid |
| SMILES | COc1cccn2c(=O)c(CO)c(Nc3ccc(CP(=O)(O)O)cc3)nc12 |
| InChI | InChI=1S/C17H18N3O6P/c1-26-14-3-2-8-20-16(14)19-15(13(9-21)17(20)22)18-12-6-4-11(5-7-12)10-27(23,24)25/h2-8,18,21H,9-10H2,1H3,(H2,23,24,25) |
| InChIKey | GTNPHLLPVDPMHZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|