C23H20N4O4 — CID 67313791
ethyl (E)-3-[9-methoxy-4-oxo-2-(quinolin-6-ylamino)pyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate (PubChem CID 67313791) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is ethyl (E)-3-[9-methoxy-4-oxo-2-(quinolin-6-ylamino)pyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[9-methoxy-4-oxo-2-(quinolin-6-ylamino)pyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 67313791 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | ethyl (E)-3-[9-methoxy-4-oxo-2-(quinolin-6-ylamino)pyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c(Nc2ccc3ncccc3c2)nc2c(OC)cccn2c1=O |
| InChI | InChI=1S/C23H20N4O4/c1-3-31-20(28)11-9-17-21(25-16-8-10-18-15(14-16)6-4-12-24-18)26-22-19(30-2)7-5-13-27(22)23(17)29/h4-14,25H,3H2,1-2H3/b11-9+ |
| InChIKey | XEYSUXFDRSIDMP-PKNBQFBNSA-N |
| XLogP | 3.57 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|