About azanide;2-[4-fluoro-2-(trifluoromethyl)phenyl]-1-sulfidoazirine;tungsten(2+)
azanide;2-[4-fluoro-2-(trifluoromethyl)phenyl]-1-sulfidoazirine;tungsten(2+) (PubChem CID 143923810) has the molecular formula C9H6F4N2SW
and a molecular weight of 434.06 g/mol. Its IUPAC name is azanide;2-[4-fluoro-2-(trifluoromethyl)phenyl]-1-sulfidoazirine;tungsten(2+).
Molecular Properties
| Compound Name | azanide;2-[4-fluoro-2-(trifluoromethyl)phenyl]-1-sulfidoazirine;tungsten(2+) |
| PubChem CID | 143923810 |
| Molecular Formula | C9H6F4N2SW |
| Molecular Weight | 434.06 g/mol |
| Exact Mass | 433.97 |
| IUPAC Name | azanide;2-[4-fluoro-2-(trifluoromethyl)phenyl]-1-sulfidoazirine;tungsten(2+) |
| SMILES | Fc1ccc(C2=CN2[S-])c(C(F)(F)F)c1.[NH2-].[W+2] |
| InChI | InChI=1S/C9H4F4NS.H2N.W/c10-5-1-2-6(8-4-14(8)15)7(3-5)9(11,12)13;;/h1-4H;1H2;/q2*-1;+2 |
| InChIKey | NOLCMNDAEVIMBD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 36.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.06 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze azanide;2-[4-fluoro-2-(trifluoromethyl)phenyl]-1-sulfidoazirine;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;2-[4-fluoro-2-(trifluoromethyl)phenyl]-1-sulfidoazirine;tungsten(2+)?
The IUPAC name of azanide;2-[4-fluoro-2-(trifluoromethyl)phenyl]-1-sulfidoazirine;tungsten(2+) (CID 143923810) is azanide;2-[4-fluoro-2-(trifluoromethyl)phenyl]-1-sulfidoazirine;tungsten(2+).
What is the SMILES notation for azanide;2-[4-fluoro-2-(trifluoromethyl)phenyl]-1-sulfidoazirine;tungsten(2+)?
The canonical SMILES for azanide;2-[4-fluoro-2-(trifluoromethyl)phenyl]-1-sulfidoazirine;tungsten(2+) is Fc1ccc(C2=CN2[S-])c(C(F)(F)F)c1.[NH2-].[W+2].
What is the InChIKey of azanide;2-[4-fluoro-2-(trifluoromethyl)phenyl]-1-sulfidoazirine;tungsten(2+)?
The InChIKey is NOLCMNDAEVIMBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F4NS.H2N.W/c10-5-1-2-6(8-4-14(8)15)7(3-5)9(11,12)13;;/h1-4H;1H2;/q2*-1;+2.
What are the key properties of azanide;2-[4-fluoro-2-(trifluoromethyl)phenyl]-1-sulfidoazirine;tungsten(2+)?
azanide;2-[4-fluoro-2-(trifluoromethyl)phenyl]-1-sulfidoazirine;tungsten(2+) has a molecular weight of 434.06 g/mol, XLogP of 3.63, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;2-[4-fluoro-2-(trifluoromethyl)phenyl]-1-sulfidoazirine;tungsten(2+) is sourced from PubChem (CID 143923810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).