About 4-fluoro-1-(1,1,2-trifluoroethyl)-2-(trifluoromethyl)benzene
4-fluoro-1-(1,1,2-trifluoroethyl)-2-(trifluoromethyl)benzene (PubChem CID 21036142) has the molecular formula C9H5F7
and a molecular weight of 246.12 g/mol. Its IUPAC name is 4-fluoro-1-(1,1,2-trifluoroethyl)-2-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 4-fluoro-1-(1,1,2-trifluoroethyl)-2-(trifluoromethyl)benzene |
| PubChem CID | 21036142 |
| Molecular Formula | C9H5F7 |
| Molecular Weight | 246.12 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 4-fluoro-1-(1,1,2-trifluoroethyl)-2-(trifluoromethyl)benzene |
| SMILES | FCC(F)(F)c1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C9H5F7/c10-4-8(12,13)6-2-1-5(11)3-7(6)9(14,15)16/h1-3H,4H2 |
| InChIKey | XXZSERPJTQYNKL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.12 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-fluoro-1-(1,1,2-trifluoroethyl)-2-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1-(1,1,2-trifluoroethyl)-2-(trifluoromethyl)benzene?
The IUPAC name of 4-fluoro-1-(1,1,2-trifluoroethyl)-2-(trifluoromethyl)benzene (CID 21036142) is 4-fluoro-1-(1,1,2-trifluoroethyl)-2-(trifluoromethyl)benzene.
What is the SMILES notation for 4-fluoro-1-(1,1,2-trifluoroethyl)-2-(trifluoromethyl)benzene?
The canonical SMILES for 4-fluoro-1-(1,1,2-trifluoroethyl)-2-(trifluoromethyl)benzene is FCC(F)(F)c1ccc(F)cc1C(F)(F)F.
What is the InChIKey of 4-fluoro-1-(1,1,2-trifluoroethyl)-2-(trifluoromethyl)benzene?
The InChIKey is XXZSERPJTQYNKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F7/c10-4-8(12,13)6-2-1-5(11)3-7(6)9(14,15)16/h1-3H,4H2.
What are the key properties of 4-fluoro-1-(1,1,2-trifluoroethyl)-2-(trifluoromethyl)benzene?
4-fluoro-1-(1,1,2-trifluoroethyl)-2-(trifluoromethyl)benzene has a molecular weight of 246.12 g/mol, XLogP of 3.91, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1-(1,1,2-trifluoroethyl)-2-(trifluoromethyl)benzene is sourced from PubChem (CID 21036142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).