About acetamide;N-(3-fluoro-4-piperazin-1-ylphenyl)-3-methylbutanamide
acetamide;N-(3-fluoro-4-piperazin-1-ylphenyl)-3-methylbutanamide (PubChem CID 143923829) has the molecular formula C17H27FN4O2
and a molecular weight of 338.43 g/mol. Its IUPAC name is acetamide;N-(3-fluoro-4-piperazin-1-ylphenyl)-3-methylbutanamide.
Molecular Properties
| Compound Name | acetamide;N-(3-fluoro-4-piperazin-1-ylphenyl)-3-methylbutanamide |
| PubChem CID | 143923829 |
| Molecular Formula | C17H27FN4O2 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | acetamide;N-(3-fluoro-4-piperazin-1-ylphenyl)-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(N2CCNCC2)c(F)c1.CC(N)=O |
| InChI | InChI=1S/C15H22FN3O.C2H5NO/c1-11(2)9-15(20)18-12-3-4-14(13(16)10-12)19-7-5-17-6-8-19;1-2(3)4/h3-4,10-11,17H,5-9H2,1-2H3,(H,18,20);1H3,(H2,3,4) |
| InChIKey | XYIYCWGWFGFGPB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze acetamide;N-(3-fluoro-4-piperazin-1-ylphenyl)-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;N-(3-fluoro-4-piperazin-1-ylphenyl)-3-methylbutanamide?
The IUPAC name of acetamide;N-(3-fluoro-4-piperazin-1-ylphenyl)-3-methylbutanamide (CID 143923829) is acetamide;N-(3-fluoro-4-piperazin-1-ylphenyl)-3-methylbutanamide.
What is the SMILES notation for acetamide;N-(3-fluoro-4-piperazin-1-ylphenyl)-3-methylbutanamide?
The canonical SMILES for acetamide;N-(3-fluoro-4-piperazin-1-ylphenyl)-3-methylbutanamide is CC(C)CC(=O)Nc1ccc(N2CCNCC2)c(F)c1.CC(N)=O.
What is the InChIKey of acetamide;N-(3-fluoro-4-piperazin-1-ylphenyl)-3-methylbutanamide?
The InChIKey is XYIYCWGWFGFGPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22FN3O.C2H5NO/c1-11(2)9-15(20)18-12-3-4-14(13(16)10-12)19-7-5-17-6-8-19;1-2(3)4/h3-4,10-11,17H,5-9H2,1-2H3,(H,18,20);1H3,(H2,3,4).
What are the key properties of acetamide;N-(3-fluoro-4-piperazin-1-ylphenyl)-3-methylbutanamide?
acetamide;N-(3-fluoro-4-piperazin-1-ylphenyl)-3-methylbutanamide has a molecular weight of 338.43 g/mol, XLogP of 1.71, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;N-(3-fluoro-4-piperazin-1-ylphenyl)-3-methylbutanamide is sourced from PubChem (CID 143923829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).