C19H31FN4O — CID 167510609
ethane;4-(3-fluoro-4-piperazin-1-ylanilino)-N-methylhex-5-enamide (PubChem CID 167510609) has the molecular formula C19H31FN4O and a molecular weight of 350.48 g/mol. Its IUPAC name is ethane;4-(3-fluoro-4-piperazin-1-ylanilino)-N-methylhex-5-enamide.
| Compound Name | ethane;4-(3-fluoro-4-piperazin-1-ylanilino)-N-methylhex-5-enamide |
|---|---|
| PubChem CID | 167510609 |
| Molecular Formula | C19H31FN4O |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | ethane;4-(3-fluoro-4-piperazin-1-ylanilino)-N-methylhex-5-enamide |
| SMILES | C=CC(CCC(=O)NC)Nc1ccc(N2CCNCC2)c(F)c1.CC |
| InChI | InChI=1S/C17H25FN4O.C2H6/c1-3-13(5-7-17(23)19-2)21-14-4-6-16(15(18)12-14)22-10-8-20-9-11-22;1-2/h3-4,6,12-13,20-21H,1,5,7-11H2,2H3,(H,19,23);1-2H3 |
| InChIKey | FRVNIXTUGWWHTF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|