C17H23FN4O — CID 56805411
N-(2-cyanoethyl)-2-(3-fluoro-4-pyrrolidin-1-ylanilino)-N-methylpropanamide (PubChem CID 56805411) has the molecular formula C17H23FN4O and a molecular weight of 318.40 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(3-fluoro-4-pyrrolidin-1-ylanilino)-N-methylpropanamide.
| Compound Name | N-(2-cyanoethyl)-2-(3-fluoro-4-pyrrolidin-1-ylanilino)-N-methylpropanamide |
|---|---|
| PubChem CID | 56805411 |
| Molecular Formula | C17H23FN4O |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-(2-cyanoethyl)-2-(3-fluoro-4-pyrrolidin-1-ylanilino)-N-methylpropanamide |
| SMILES | CC(Nc1ccc(N2CCCC2)c(F)c1)C(=O)N(C)CCC#N |
| InChI | InChI=1S/C17H23FN4O/c1-13(17(23)21(2)9-5-8-19)20-14-6-7-16(15(18)12-14)22-10-3-4-11-22/h6-7,12-13,20H,3-5,9-11H2,1-2H3 |
| InChIKey | RRQSJHRKOSFTMF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|