C18H29N3O4 — CID 143923996
methyl 4-[3-(5-methoxycyclooctyl)propanoylamino]-1-methylpyrazole-3-carboxylate (PubChem CID 143923996) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is methyl 4-[3-(5-methoxycyclooctyl)propanoylamino]-1-methylpyrazole-3-carboxylate.
| Compound Name | methyl 4-[3-(5-methoxycyclooctyl)propanoylamino]-1-methylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 143923996 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | methyl 4-[3-(5-methoxycyclooctyl)propanoylamino]-1-methylpyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(C)cc1NC(=O)CCC1CCCC(OC)CCC1 |
| InChI | InChI=1S/C18H29N3O4/c1-21-12-15(17(20-21)18(23)25-3)19-16(22)11-10-13-6-4-8-14(24-2)9-5-7-13/h12-14H,4-11H2,1-3H3,(H,19,22) |
| InChIKey | QWLTUCFBRSPFBR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |