C17H21NO3S — CID 143925978
methyl (2R)-4-methyl-2-(naphthalen-2-ylsulfinylamino)pentanoate (PubChem CID 143925978) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is methyl (2R)-4-methyl-2-(naphthalen-2-ylsulfinylamino)pentanoate.
| Compound Name | methyl (2R)-4-methyl-2-(naphthalen-2-ylsulfinylamino)pentanoate |
|---|---|
| PubChem CID | 143925978 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | methyl (2R)-4-methyl-2-(naphthalen-2-ylsulfinylamino)pentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NS(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H21NO3S/c1-12(2)10-16(17(19)21-3)18-22(20)15-9-8-13-6-4-5-7-14(13)11-15/h4-9,11-12,16,18H,10H2,1-3H3/t16-,22?/m1/s1 |
| InChIKey | WSHOOBIJTTUIIL-XESZBRCGSA-N |
| XLogP | 3.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |