C20H25N5O2 — CID 143926757
4-amino-6-[(4-benzylmorpholin-2-yl)methylamino]-2-ethoxypyridine-3-carbonitrile (PubChem CID 143926757) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-amino-6-[(4-benzylmorpholin-2-yl)methylamino]-2-ethoxypyridine-3-carbonitrile.
| Compound Name | 4-amino-6-[(4-benzylmorpholin-2-yl)methylamino]-2-ethoxypyridine-3-carbonitrile |
|---|---|
| PubChem CID | 143926757 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 4-amino-6-[(4-benzylmorpholin-2-yl)methylamino]-2-ethoxypyridine-3-carbonitrile |
| SMILES | CCOc1nc(NCC2CN(Cc3ccccc3)CCO2)cc(N)c1C#N |
| InChI | InChI=1S/C20H25N5O2/c1-2-26-20-17(11-21)18(22)10-19(24-20)23-12-16-14-25(8-9-27-16)13-15-6-4-3-5-7-15/h3-7,10,16H,2,8-9,12-14H2,1H3,(H3,22,23,24) |
| InChIKey | HICOVNDJLBXTKT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |