C18H23NO3 — CID 143927615
N-[2-[(8R)-4-methoxy-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]prop-2-enyl]propanamide (PubChem CID 143927615) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[2-[(8R)-4-methoxy-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]prop-2-enyl]propanamide.
| Compound Name | N-[2-[(8R)-4-methoxy-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]prop-2-enyl]propanamide |
|---|---|
| PubChem CID | 143927615 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | N-[2-[(8R)-4-methoxy-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]prop-2-enyl]propanamide |
| SMILES | C=C(CNC(=O)CC)[C@@H]1CCc2cc(OC)c3c(c21)CCO3 |
| InChI | InChI=1S/C18H23NO3/c1-4-16(20)19-10-11(2)13-6-5-12-9-15(21-3)18-14(17(12)13)7-8-22-18/h9,13H,2,4-8,10H2,1,3H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | YLVFKXDLLAZEID-ZDUSSCGKSA-N |
| XLogP | 2.74 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|