C23H34FNO2 — CID 143927879
2,2-dimethylbutane;4-[(4-fluorophenyl)methoxy]-N,2,6-trimethylaniline;formaldehyde (PubChem CID 143927879) has the molecular formula C23H34FNO2 and a molecular weight of 375.53 g/mol. Its IUPAC name is 2,2-dimethylbutane;4-[(4-fluorophenyl)methoxy]-N,2,6-trimethylaniline;formaldehyde.
| Compound Name | 2,2-dimethylbutane;4-[(4-fluorophenyl)methoxy]-N,2,6-trimethylaniline;formaldehyde |
|---|---|
| PubChem CID | 143927879 |
| Molecular Formula | C23H34FNO2 |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | 2,2-dimethylbutane;4-[(4-fluorophenyl)methoxy]-N,2,6-trimethylaniline;formaldehyde |
| SMILES | C=O.CCC(C)(C)C.CNc1c(C)cc(OCc2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C16H18FNO.C6H14.CH2O/c1-11-8-15(9-12(2)16(11)18-3)19-10-13-4-6-14(17)7-5-13;1-5-6(2,3)4;1-2/h4-9,18H,10H2,1-3H3;5H2,1-4H3;1H2 |
| InChIKey | XNNBPTUSDULSLA-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|