C22H30FNO2 — CID 143927899
2,2-dimethylbutane;N-[4-[(3-fluorophenyl)methoxy]-2,6-dimethylphenyl]formamide (PubChem CID 143927899) has the molecular formula C22H30FNO2 and a molecular weight of 359.49 g/mol. Its IUPAC name is 2,2-dimethylbutane;N-[4-[(3-fluorophenyl)methoxy]-2,6-dimethylphenyl]formamide.
| Compound Name | 2,2-dimethylbutane;N-[4-[(3-fluorophenyl)methoxy]-2,6-dimethylphenyl]formamide |
|---|---|
| PubChem CID | 143927899 |
| Molecular Formula | C22H30FNO2 |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 2,2-dimethylbutane;N-[4-[(3-fluorophenyl)methoxy]-2,6-dimethylphenyl]formamide |
| SMILES | CCC(C)(C)C.Cc1cc(OCc2cccc(F)c2)cc(C)c1NC=O |
| InChI | InChI=1S/C16H16FNO2.C6H14/c1-11-6-15(7-12(2)16(11)18-10-19)20-9-13-4-3-5-14(17)8-13;1-5-6(2,3)4/h3-8,10H,9H2,1-2H3,(H,18,19);5H2,1-4H3 |
| InChIKey | DJYXZLBGGQZVPK-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|