C27H33N3O4S — CID 143930274
benzene;6-[2-hydroxy-2-(methylsulfanylamino)propyl]-3-[1-[4-(6-oxo-1H-pyridin-3-yl)phenyl]ethyl]-1,3-oxazinan-2-one (PubChem CID 143930274) has the molecular formula C27H33N3O4S and a molecular weight of 495.65 g/mol. Its IUPAC name is benzene;6-[2-hydroxy-2-(methylsulfanylamino)propyl]-3-[1-[4-(6-oxo-1H-pyridin-3-yl)phenyl]ethyl]-1,3-oxazinan-2-one.
| Compound Name | benzene;6-[2-hydroxy-2-(methylsulfanylamino)propyl]-3-[1-[4-(6-oxo-1H-pyridin-3-yl)phenyl]ethyl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 143930274 |
| Molecular Formula | C27H33N3O4S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | benzene;6-[2-hydroxy-2-(methylsulfanylamino)propyl]-3-[1-[4-(6-oxo-1H-pyridin-3-yl)phenyl]ethyl]-1,3-oxazinan-2-one |
| SMILES | CSNC(C)(O)CC1CCN(C(C)c2ccc(-c3ccc(=O)[nH]c3)cc2)C(=O)O1.c1ccccc1 |
| InChI | InChI=1S/C21H27N3O4S.C6H6/c1-14(15-4-6-16(7-5-15)17-8-9-19(25)22-13-17)24-11-10-18(28-20(24)26)12-21(2,27)23-29-3;1-2-4-6-5-3-1/h4-9,13-14,18,23,27H,10-12H2,1-3H3,(H,22,25);1-6H |
| InChIKey | WVUSJWBAVZSFKA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|