C26H30N2O3 — CID 143930322
benzene;5-[4-[1-[4-(2-hydroxyethyl)-2-oxopiperidin-1-yl]ethyl]phenyl]-1H-pyridin-2-one (PubChem CID 143930322) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is benzene;5-[4-[1-[4-(2-hydroxyethyl)-2-oxopiperidin-1-yl]ethyl]phenyl]-1H-pyridin-2-one.
| Compound Name | benzene;5-[4-[1-[4-(2-hydroxyethyl)-2-oxopiperidin-1-yl]ethyl]phenyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 143930322 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | benzene;5-[4-[1-[4-(2-hydroxyethyl)-2-oxopiperidin-1-yl]ethyl]phenyl]-1H-pyridin-2-one |
| SMILES | CC(c1ccc(-c2ccc(=O)[nH]c2)cc1)N1CCC(CCO)CC1=O.c1ccccc1 |
| InChI | InChI=1S/C20H24N2O3.C6H6/c1-14(22-10-8-15(9-11-23)12-20(22)25)16-2-4-17(5-3-16)18-6-7-19(24)21-13-18;1-2-4-6-5-3-1/h2-7,13-15,23H,8-12H2,1H3,(H,21,24);1-6H |
| InChIKey | JXJQKLXKNYQYGV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |