C31H24F5N3O6 — CID 143931773
ethyl 1-[2-[(1,3-dioxoisoindol-2-yl)methyl]-2,3,3,3-tetrafluoropropyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-8-methyl-2-oxo-1,5-naphthyridine-3-carboxylate (PubChem CID 143931773) has the molecular formula C31H24F5N3O6 and a molecular weight of 629.54 g/mol. Its IUPAC name is ethyl 1-[2-[(1,3-dioxoisoindol-2-yl)methyl]-2,3,3,3-tetrafluoropropyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-8-methyl-2-oxo-1,5-naphthyridine-3-carboxylate.
| Compound Name | ethyl 1-[2-[(1,3-dioxoisoindol-2-yl)methyl]-2,3,3,3-tetrafluoropropyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-8-methyl-2-oxo-1,5-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 143931773 |
| Molecular Formula | C31H24F5N3O6 |
| Molecular Weight | 629.54 g/mol |
| Exact Mass | 629.16 |
| IUPAC Name | ethyl 1-[2-[(1,3-dioxoisoindol-2-yl)methyl]-2,3,3,3-tetrafluoropropyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-8-methyl-2-oxo-1,5-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(O)c2ncc(Cc3ccc(F)cc3)c(C)c2n(CC(F)(CN2C(=O)c3ccccc3C2=O)C(F)(F)F)c1=O |
| InChI | InChI=1S/C31H24F5N3O6/c1-3-45-29(44)22-25(40)23-24(16(2)18(13-37-23)12-17-8-10-19(32)11-9-17)38(28(22)43)14-30(33,31(34,35)36)15-39-26(41)20-6-4-5-7-21(20)27(39)42/h4-11,13,40H,3,12,14-15H2,1-2H3 |
| InChIKey | UCACUCMUZLBRJA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|