C21H17FN2O4 — CID 59158271
ethyl 5-[(4-fluorophenyl)methyl]-9-hydroxy-3-methyl-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaene-10-carboxylate (PubChem CID 59158271) has the molecular formula C21H17FN2O4 and a molecular weight of 380.38 g/mol. Its IUPAC name is ethyl 5-[(4-fluorophenyl)methyl]-9-hydroxy-3-methyl-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaene-10-carboxylate.
| Compound Name | ethyl 5-[(4-fluorophenyl)methyl]-9-hydroxy-3-methyl-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaene-10-carboxylate |
|---|---|
| PubChem CID | 59158271 |
| Molecular Formula | C21H17FN2O4 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | ethyl 5-[(4-fluorophenyl)methyl]-9-hydroxy-3-methyl-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaene-10-carboxylate |
| SMILES | CCOC(=O)c1c(O)c2ncc(Cc3ccc(F)cc3)c3c(C)cn(c1=O)c23 |
| InChI | InChI=1S/C21H17FN2O4/c1-3-28-21(27)16-19(25)17-18-15(11(2)10-24(18)20(16)26)13(9-23-17)8-12-4-6-14(22)7-5-12/h4-7,9-10,25H,3,8H2,1-2H3 |
| InChIKey | PDIRKKWOIOVQDU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |