C20H20F3N7O — CID 1439333
N-[4-(tetrazol-1-yl)phenyl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide (PubChem CID 1439333) has the molecular formula C20H20F3N7O and a molecular weight of 431.42 g/mol. Its IUPAC name is N-[4-(tetrazol-1-yl)phenyl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide.
| Compound Name | N-[4-(tetrazol-1-yl)phenyl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 1439333 |
| Molecular Formula | C20H20F3N7O |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-[4-(tetrazol-1-yl)phenyl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(c2cccc(C(F)(F)F)c2)CC1)Nc1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C20H20F3N7O/c21-20(22,23)15-2-1-3-18(12-15)29-10-8-28(9-11-29)13-19(31)25-16-4-6-17(7-5-16)30-14-24-26-27-30/h1-7,12,14H,8-11,13H2,(H,25,31) |
| InChIKey | VSIBBTSVYIVLSP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |