C18H25NO3S — CID 143933460
4-[(4-butoxyphenyl)methyl]-2-methyl-1,3-thiazole-5-carboxylic acid;ethane (PubChem CID 143933460) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is 4-[(4-butoxyphenyl)methyl]-2-methyl-1,3-thiazole-5-carboxylic acid;ethane.
| Compound Name | 4-[(4-butoxyphenyl)methyl]-2-methyl-1,3-thiazole-5-carboxylic acid;ethane |
|---|---|
| PubChem CID | 143933460 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 4-[(4-butoxyphenyl)methyl]-2-methyl-1,3-thiazole-5-carboxylic acid;ethane |
| SMILES | CC.CCCCOc1ccc(Cc2nc(C)sc2C(=O)O)cc1 |
| InChI | InChI=1S/C16H19NO3S.C2H6/c1-3-4-9-20-13-7-5-12(6-8-13)10-14-15(16(18)19)21-11(2)17-14;1-2/h5-8H,3-4,9-10H2,1-2H3,(H,18,19);1-2H3 |
| InChIKey | KEIZBJIUDCQSLI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|