C11H17NO2S — CID 19885553
4-hexyl-2-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 19885553) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 4-hexyl-2-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-hexyl-2-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 19885553 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 4-hexyl-2-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | CCCCCCc1nc(C)sc1C(=O)O |
| InChI | InChI=1S/C11H17NO2S/c1-3-4-5-6-7-9-10(11(13)14)15-8(2)12-9/h3-7H2,1-2H3,(H,13,14) |
| InChIKey | UTNBJDASAVWTMT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|