C19H31NO3S — CID 21406428
7-[5-[(E)-3-hydroxyoct-1-enyl]-2-methyl-1,3-thiazol-4-yl]heptanoic acid (PubChem CID 21406428) has the molecular formula C19H31NO3S and a molecular weight of 353.53 g/mol. Its IUPAC name is 7-[5-[(E)-3-hydroxyoct-1-enyl]-2-methyl-1,3-thiazol-4-yl]heptanoic acid.
| Compound Name | 7-[5-[(E)-3-hydroxyoct-1-enyl]-2-methyl-1,3-thiazol-4-yl]heptanoic acid |
|---|---|
| PubChem CID | 21406428 |
| Molecular Formula | C19H31NO3S |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 7-[5-[(E)-3-hydroxyoct-1-enyl]-2-methyl-1,3-thiazol-4-yl]heptanoic acid |
| SMILES | CCCCCC(O)/C=C/c1sc(C)nc1CCCCCCC(=O)O |
| InChI | InChI=1S/C19H31NO3S/c1-3-4-7-10-16(21)13-14-18-17(20-15(2)24-18)11-8-5-6-9-12-19(22)23/h13-14,16,21H,3-12H2,1-2H3,(H,22,23)/b14-13+ |
| InChIKey | MDJWDHXHJXTDBH-BUHFOSPRSA-N |
| XLogP | 4.98 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|