C18H28O4 — CID 171116348
(E,6S)-6-hydroxy-8-(5-oxo-2-pentylcyclopenten-1-yl)oct-7-enoic acid (PubChem CID 171116348) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is (E,6S)-6-hydroxy-8-(5-oxo-2-pentylcyclopenten-1-yl)oct-7-enoic acid.
| Compound Name | (E,6S)-6-hydroxy-8-(5-oxo-2-pentylcyclopenten-1-yl)oct-7-enoic acid |
|---|---|
| PubChem CID | 171116348 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (E,6S)-6-hydroxy-8-(5-oxo-2-pentylcyclopenten-1-yl)oct-7-enoic acid |
| SMILES | CCCCCC1=C(/C=C/[C@@H](O)CCCCC(=O)O)C(=O)CC1 |
| InChI | InChI=1S/C18H28O4/c1-2-3-4-7-14-10-13-17(20)16(14)12-11-15(19)8-5-6-9-18(21)22/h11-12,15,19H,2-10,13H2,1H3,(H,21,22)/b12-11+/t15-/m0/s1 |
| InChIKey | MVZMDNUXMOUJKS-RUMSDORHSA-N |
| XLogP | 3.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|