C18H26O4 — CID 171116355
(6Z,9R,10E)-11-(2-ethyl-5-oxocyclopenten-1-yl)-9-hydroxyundeca-6,10-dienoic acid (PubChem CID 171116355) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (6Z,9R,10E)-11-(2-ethyl-5-oxocyclopenten-1-yl)-9-hydroxyundeca-6,10-dienoic acid.
| Compound Name | (6Z,9R,10E)-11-(2-ethyl-5-oxocyclopenten-1-yl)-9-hydroxyundeca-6,10-dienoic acid |
|---|---|
| PubChem CID | 171116355 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (6Z,9R,10E)-11-(2-ethyl-5-oxocyclopenten-1-yl)-9-hydroxyundeca-6,10-dienoic acid |
| SMILES | CCC1=C(/C=C/[C@H](O)C/C=C\CCCCC(=O)O)C(=O)CC1 |
| InChI | InChI=1S/C18H26O4/c1-2-14-10-13-17(20)16(14)12-11-15(19)8-6-4-3-5-7-9-18(21)22/h4,6,11-12,15,19H,2-3,5,7-10,13H2,1H3,(H,21,22)/b6-4-,12-11+/t15-/m1/s1 |
| InChIKey | PUYPSEXBAZYXKI-ISMKHINLSA-N |
| XLogP | 3.56 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|