C15H22FNO2 — CID 143934977
1-[4-[3-[(3R)-3-fluoropyrrolidin-1-yl]propyl]phenoxy]ethanol (PubChem CID 143934977) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is 1-[4-[3-[(3R)-3-fluoropyrrolidin-1-yl]propyl]phenoxy]ethanol.
| Compound Name | 1-[4-[3-[(3R)-3-fluoropyrrolidin-1-yl]propyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 143934977 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 1-[4-[3-[(3R)-3-fluoropyrrolidin-1-yl]propyl]phenoxy]ethanol |
| SMILES | CC(O)Oc1ccc(CCCN2CC[C@@H](F)C2)cc1 |
| InChI | InChI=1S/C15H22FNO2/c1-12(18)19-15-6-4-13(5-7-15)3-2-9-17-10-8-14(16)11-17/h4-7,12,14,18H,2-3,8-11H2,1H3/t12?,14-/m1/s1 |
| InChIKey | PDVQXFNQABOTMZ-TYZXPVIJSA-N |
| XLogP | 2.38 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|